4-Aminocarbonylphenylboronic acid is a boronic acid derivative containing an amide functional group and an aromatic ring. It is primarily used as a research reagent in boron chemistry and related synthetic applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 123088-59-5
(S)-3-([1,1'-biphenyl]-4-yl)-2-amino-2-methylpropanoic acid
research compound
(S)-2-Amino-2-methylpent-4-ynoic acid
Research compound
EthaniMidaMide, N-(4-broMo-2,6-difluorophenyl)-N'-(1-Methylethyl)-
research compound
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
(4-carbamoylphenyl)boronic acid
GNRHNKBJNUVWFZ-UHFFFAOYSA-N
B(C1=CC=C(C=C1)C(=O)N)(O)O