This compound is a research reagent featuring an aromatic ring with bromine and fluorine substituents. It is primarily used in laboratory settings for chemical and biological studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1231930-29-2
(S)-GLYCIDOXY-T-BUTYLDIMETHYLSILANE
Research reagent for organic synthesis
1-(3-bromophenyl)-3,5-diphenylbenzene
research compound
4-tert-Butylphenylboronic acid
organic synthesis building block
1-Hydroxybenzotriazole hydrate
Reagent in synthetic organic chemistry
N-(4-bromo-2,6-difluorophenyl)-N'-propan-2-ylethanimidamide
SCDDZPXMZYLKLU-UHFFFAOYSA-N
CC(C)N=C(C)NC1=C(C=C(C=C1F)Br)F