This compound is a polychlorinated biphenyl derivative featuring a fully deuterium-labeled phenyl ring and a deuterium-labeled cyclohexadiene ring containing two chlorine substituents. It is a highly specific isotopically labeled research compound used in analytical and environmental studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1219804-50-8
Acamprosate-d12 Calcium (dipropyl-d12)
isotopically labeled research compound
L-Methionine-d3
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
2,4,5-trichloroaniline-d4
deuterated analytical reference standard
2,4-Difluorobenzoic Acid-d3
deuterated research compound
2-phenoxyethyl-1,1,2,2-d4 alcohol
deuterated research reference standard
4-N-Butylanisole-2,3,5,6-d4
deuterated research compound
3,6-dichloro-1,2,3,4,6-pentadeuterio-5-(2,3,4,5,6-pentadeuteriophenyl)cyclohexa-1,4-diene
KQVWSTQXDLZRRK-YINOKFNYSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])C2=C(C(C(=C(C2([2H])Cl)[2H])[2H])([2H])Cl)[2H])[2H])[2H]
—