This compound is a stable isotope labeled research compound, specifically a dinitrogen-15 labeled form of alanosine. Its primary significance lies in its use as a labeled internal standard for analytical and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء D,L-Alanosine-15N2؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
3-nitrobenzyl-d6 alcohol
stable isotope labeled research compound
Menaquinone 7-d7
stable isotope labeled research compound
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Allantoin-13C2,15N4
isotopically labeled research compound
2-DIFLUOROMETHANESULFONYLPYRIDINE
research compound
N-Nitrosodiethylamine-d10
Deuterated internal standard for analytical research
4-N-OCTYL-D17-PHENOL
deuterated research standard
(2-amino-2-carboxyethyl)-(15N)hydroxyimino-oxido(15N)azanium
ZGNLFUXWZJGETL-MPOCSFTDSA-N
C(C(C(=O)O)N)[15N+](=[15N]O)[O-]
هل تبحث عن شراء D,L-Alanosine-15N2؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.