This compound is a chiral amino alcohol derivative bearing a 4-chlorophenyl substituent, typically supplied as a research reagent. Its structure includes an aromatic ring, an alcohol group, and an amine group, contributing to its use in laboratory investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1213362-28-7
Palladium hydroxide
Catalyst for hydrogenolysis reactions
(7-Bromo-9,9-dimethyl-9H-fluoren-2-yl)boronic Acid (contains varying amounts of Anhydride)
organic synthesis intermediate
2'-Hydroxychalcone
research compound
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
Boron reagent for cross-coupling
(3s)-3-amino-3-(4-chlorophenyl)propan-1-ol
research compound
(3R)-3-amino-3-(4-chlorophenyl)propan-1-ol
JGNACDMQJLVKIU-SECBINFHSA-N
C1=CC(=CC=C1[C@@H](CCO)N)Cl
—