This compound is a boronic acid derivative used primarily as an intermediate in organic synthesis, particularly in the construction of complex molecular architectures. Its structure features a brominated fluorene core, which imparts specific reactivity for cross-coupling reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1213768-48-9
2'-Hydroxychalcone
research compound
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine
Boron reagent for cross-coupling
Methyl 5-bromo-3-(trifluoromethyl)pyridine-2-carboxylate
Research chemical intermediate
Methyl 5-bromo-6-methoxypicolinate
research compound
(7-bromo-9,9-dimethylfluoren-2-yl)boronic acid
CYZUULREWZKGJP-UHFFFAOYSA-N
B(C1=CC2=C(C=C1)C3=C(C2(C)C)C=C(C=C3)Br)(O)O
—