(R)-2-Methyl-CBS-oxazaborolidine is a chiral oxazaborolidine compound used as an asymmetric reduction catalyst in organic synthesis. It is characterized by a heterocyclic structure containing boron and nitrogen atoms, with diphenyl substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 112022-83-0
UNA 2-OBz U amidite
Oligonucleotide synthesis phosphoramidite reagent
(2R)-2-(6-Benzamido-9H-purin-9-yl)-2-(((2R)-1-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)ethyl benzoate
oligonucleotide synthesis phosphoramidite reagent
UNA-C(Ac)-CE Phosphoramidite
Oligonucleotide synthesis phosphoramidite reagent
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
(3aS)-1-methyl-3,3-diphenyl-hexahydropyrrolo[1,2-c][1,3,2]oxazaborole
asymmetric reduction catalyst
(3aR)-1-methyl-3,3-diphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole
VMKAFJQFKBASMU-QGZVFWFLSA-N
B1(N2CCC[C@@H]2C(O1)(C3=CC=CC=C3)C4=CC=CC=C4)C