This compound is a phosphoramidite reagent designed for oligonucleotide synthesis, specifically incorporating a UNA (unlocked nucleic acid) monomer with a 2-O-benzoyl uridine modification. Its complex structure, featuring multiple aromatic rings and functional groups, highlights its role as a specialized building block in nucleic acid chemistry research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1120329-48-7
UNA-C(Ac)-CE Phosphoramidite
Oligonucleotide synthesis phosphoramidite reagent
(2R)-2-(6-Benzamido-9H-purin-9-yl)-2-(((2R)-1-(bis(4-methoxyphenyl)(phenyl)methoxy)-3-(((2-cyanoethoxy)(diisopropylamino)phosphino)oxy)propan-2-yl)oxy)ethyl benzoate
oligonucleotide synthesis phosphoramidite reagent
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
3-Hydroxy-2-methylpyridine
research compound
Dicyclopropyl ketone
research reagent
[(2R)-2-[(2R)-1-[bis(4-methoxyphenyl)-phenylmethoxy]-3-[2-cyanoethoxy-[di(propan-2-yl)amino]phosphanyl]oxypropan-2-yl]oxy-2-(2,4-dioxopyrimidin-1-yl)ethyl] benzoate
MHRGEJFLFYZLJI-LZOZAVILSA-N
CC(C)N(C(C)C)P(OCCC#N)OC[C@@H](COC(C1=CC=CC=C1)(C2=CC=C(C=C2)OC)C3=CC=C(C=C3)OC)O[C@H](COC(=O)C4=CC=CC=C4)N5C=CC(=O)NC5=O