5'-Tosyl-2'-deoxy Guanosine is a modified nucleoside derivative. It is a research compound featuring a tosyl protecting group at the 5' position and a guanine base, used primarily in synthetic organic chemistry and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 109954-64-5
Trihydro(pyridine)boron
Reducing agent and reagent
Benzyltriphenylphosphonium chloride
phase transfer catalyst
3-bromo-1,2,4-thiadiazol-5-amine
research compound
(3aS,5R,6S,6aS)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylic acid
Research chemical for synthetic studies
[(2R,3R,5R)-5-(2-amino-6-oxo-1H-purin-9-yl)-3-hydroxyoxolan-2-yl]methyl 4-methylbenzenesulfonate
QZERCZKEESOISM-JHJVBQTASA-N
CC1=CC=C(C=C1)S(=O)(=O)OC[C@@H]2[C@@H](C[C@@H](O2)N3C=NC4=C3N=C(NC4=O)N)O