Benzyltriphenylphosphonium chloride is a quaternary phosphonium salt commonly employed as a phase transfer catalyst in organic synthesis. It facilitates the transfer of reactants between immiscible liquid phases, enabling reactions under mild conditions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1100-88-5
Tetrabutylphosphonium bromide
phase transfer catalyst
Tbaf(tbuoh)4
phase transfer catalyst
Phosphonium, butyltriphenyl-, chloride
phase transfer catalyst
Tetrabutylammonium hydrogen sulfate
phase transfer catalyst
3-bromo-1,2,4-thiadiazol-5-amine
research compound
(3aS,5R,6S,6aS)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxole-5-carboxylic acid
Research chemical for synthetic studies
(4-chloro-3-(4-ethoxybenzyl)phenyl)((3as,5r,6s,6as)-6-hydroxy-2,2-dimethyltetrahydrofuro[2,3-d][1,3]dioxol-5-yl)methanone
research compound
1-Bromo-2-chloro-4-fluorobenzene
research compound
benzyl(triphenyl)phosphanium chloride
USFRYJRPHFMVBZ-UHFFFAOYSA-M
C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Cl-]