Boc-D-Lys-OH is a protected derivative of D-lysine where the amino group is blocked by a tert-butoxycarbonyl (Boc) group, commonly used as a building block in solid-phase peptide synthesis. Its primary significance lies in enabling the incorporation of D-lysine residues into peptide chains during laboratory-scale and industrial peptide manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 106719-44-2
(2S)-4-amino-2-{[(tert-butoxy)carbonyl]amino}butanoic acid
Protected amino acid building block
BOC-D-DAB-OH
building block in peptide synthesis
Cbz-alanine
peptide synthesis intermediate
N-Carbobenzoxy-L-aspartic acid
peptide synthesis intermediate
(S)-22-(tert-Butoxycarbonyl)-45,45-dimethyl-10,19,24,43-tetraoxo-3,6,12,15,44-pentaoxa-9,18,23-triazahexatetracontanoic acid
peptide synthesis intermediate
(2S)-4-{[(tert-butoxy)carbonyl]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)butanoic acid
peptide synthesis intermediate
Acethydrazide
pharmaceutical intermediate
Diethyl acetamidomalonate
Pharmaceutical intermediate for flurbiprofen
(2R)-6-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid
DQUHYEDEGRNAFO-MRVPVSSYSA-N
CC(C)(C)OC(=O)N[C@H](CCCCN)C(=O)O