Diethyl acetamidomalonate is a chemical compound used as an intermediate in the synthesis of the pharmaceutical agent flurbiprofen. It is structurally characterized as an N-acetyl derivative of diethyl aminomalonate.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1068-90-2
(1S,9S)-t-butyl 9-amino-octahydro-10-oxo-6H-pyridazino[1,2-a][1,2]diazepine-1-carboxylate
Pharmaceutical intermediate for cilazapril
4,5-Desisopropylidene Topiramate
Topiramate impurity or intermediate
Divinyl glycol
crosslinking agent for polycarbophil polymer
2,2-Dimethyl-4,13-dioxo-3,8,11,17,20-pentaoxa-5,14-diazadocosan-22-oic acid
pharmaceutical intermediate for PEGylation
diethyl 2-acetamidopropanedioate
ISOLMABRZPQKOV-UHFFFAOYSA-N
CCOC(=O)C(C(=O)OCC)NC(=O)C