Leupeptin hemisulfate is a peptide sulfate salt consisting of leupeptin with half an equivalent of sulfuric acid. It functions as a serine protease inhibitor and is used as a research reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 103476-89-7
N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N-methyl-D-leucine
Fmoc-protected amino acid for peptide synthesis
Quinoline-6-carboxylic acid
research compound
[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride
catalyst for cross-coupling reactions
2-Bromothiazolo[5,4-c]pyridin-4(5H)-one
Research compound for chemical synthesis
bis((2S)-2-acetamido-N-[(2S)-1-[[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]-4-methylpentanamide);sulfuric acid
CIPMKIHUGVGQTG-VFFZMTJFSA-N
CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.CC(C)C[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C(N)N)C=O)NC(=O)C.OS(=O)(=O)O