This compound is an Fmoc-protected N-methyl leucine derivative used as a building block in solid-phase peptide synthesis. It is a research reagent that incorporates a methylated backbone to introduce conformational constraints or enhance metabolic stability in synthetic peptides.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 103478-63-3
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine
Peptide synthesis building block
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid
Fmoc-protected amino acid for peptide synthesis
N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-glutamine
Fmoc-protected amino acid for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
N-(9-Fluorenylmethoxycarbonyl)-D-proline
Fmoc-protected amino acid for peptide synthesis
Quinoline-6-carboxylic acid
research compound
[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride
catalyst for cross-coupling reactions
2-Bromothiazolo[5,4-c]pyridin-4(5H)-one
Research compound for chemical synthesis
(2R)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-methylpentanoic acid
BUJQSIPFDWLNDC-HXUWFJFHSA-N
CC(C)C[C@H](C(=O)O)N(C)C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13