This compound is a pharmaceutical intermediate featuring a chiral center, an aromatic ring, and a chlorinated ketone moiety. It is primarily used as a building block in the synthesis of peptide-related compounds and other pharmaceutical agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 102123-74-0
1-(cyclopropylcarbonyl)piperazine hydrochloride
pharmaceutical intermediate
2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzonitrile
pharmaceutical intermediate
(2R)-N-(2-Benzoyl-4-chlorophenyl)-1-(phenylmethyl)-2-pyrrolidinecarboxamide Hydrochloride
Pharmaceutical intermediate for diazepam impurity
Boc-Arg(Mtr)-OH
protected arginine derivative for peptide synthesis
tert-butyl N-[(2S)-4-chloro-3-oxo-1-phenylbutan-2-yl]carbamate
JAKDNFBATYIEIE-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=CC=C1)C(=O)CCl