Boc-Arg(Mtr)-OH is a protected arginine derivative used as a building block in solid-phase peptide synthesis. Its significance lies in the orthogonal protection strategy provided by the Boc group on the alpha-amino function and the Mtr group on the guanidino side chain, enabling selective deprotection during peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 102185-38-6
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-N2-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-ornithine
protected arginine derivative for peptide synthesis
N5-[[[(2,3-Dihydro-2,2,4,6,7-pentamethyl-5-benzofuranyl)sulfonyl]amino]iminomethyl]-L-ornithine
protected arginine derivative for peptide synthesis
N-Boc-cis-4-hydroxy-L-proline methyl ester
Peptide synthesis building block
1-tert-butyl 2-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate
Boc-protected amino acid intermediate
2-Methylamino-5-chlorobenzophenone
Pharmaceutical intermediate for benzodiazepine synthesis
(3S)-3-methylmorpholine hydrochloride
pharmaceutical intermediate
(2S)-5-[[amino-[(4-methoxy-2,3,6-trimethylphenyl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid
CXZHJRGYWGPJSD-HNNXBMFYSA-N
CC1=CC(=C(C(=C1S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)N)C)C)OC