(R)-Indoline-2-carboxylic acid is a chiral compound that serves as a pharmaceutical intermediate. It is primarily used in the synthesis of active pharmaceutical ingredients due to its stereochemically defined structure.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 98167-06-7
L-(-)-3-Phenyllactic acid
pharmaceutical intermediate for drug synthesis
L-4-Hydroxyphenylglycine
pharmaceutical intermediate for drug synthesis
3-Bromofuran
pharmaceutical intermediate for drug synthesis
2-Methyl-2-adamantanol
pharmaceutical intermediate for drug synthesis
1-[(tert-butoxy)carbonyl]piperidine-2-carboxylic acid
Boc-protected piperidine carboxylic acid intermediate
(4AR,4bS,6aS,7S,9aS,9bS,11aR)-N-(tert-butyl)-4a,6a-dimethyl-2-oxohexadecahydro-1H-indeno[5,4-f]quinoline-7-carboxamide
pharmaceutical intermediate
Ethyl 2,4,5-trifluorobenzoylacetate
Pharmaceutical intermediate for fluoroquinolone antibiotics
Methyl 2-(bromomethyl)-3-nitrobenzoate
pharmaceutical intermediate
(2R)-2,3-dihydro-1H-indole-2-carboxylic acid
QNRXNRGSOJZINA-MRVPVSSYSA-N
C1[C@@H](NC2=CC=CC=C21)C(=O)O