L-(-)-3-Phenyllactic acid is a chemical compound used as a pharmaceutical intermediate in the synthesis of drug substances. It features a chiral center, a carboxylic acid group, a secondary alcohol, and an aromatic ring, contributing to its utility in organic synthesis and pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 20312-36-1
L-4-Hydroxyphenylglycine
pharmaceutical intermediate for drug synthesis
(R)-Indoline-2-carboxylic Acid
pharmaceutical intermediate for drug synthesis
(S)-4,4-Difluoropyrrolidine-2-carboxylic acid hydrochloride
pharmaceutical intermediate for drug synthesis
3-Bromofuran
pharmaceutical intermediate for drug synthesis
Bromoacetaldehyde diethyl acetal
pharmaceutical intermediate
Diethyl (phenylacetyl)propanedioate
pharmaceutical intermediate for synthesis
2,2-Dimethyl-1,3-dioxane-4,6-dione
organic synthesis intermediate
5,6-Dichloro-1,3-dihydro-2H-benzimidazol-2-one
pharmaceutical intermediate
(2S)-2-hydroxy-3-phenylpropanoic acid
VOXXWSYKYCBWHO-QMMMGPOBSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)O)O