L-4-Hydroxyphenylglycine is a chiral amino acid derivative used as a pharmaceutical intermediate in drug synthesis. It features an aromatic ring, a primary amine, and a carboxylic acid group, contributing to its polarity and moderate lipophilicity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 32462-30-9
(R)-Indoline-2-carboxylic Acid
pharmaceutical intermediate for drug synthesis
(S)-4,4-Difluoropyrrolidine-2-carboxylic acid hydrochloride
pharmaceutical intermediate for drug synthesis
L-(-)-3-Phenyllactic acid
pharmaceutical intermediate for drug synthesis
2-Methyl-2-adamantanol
pharmaceutical intermediate for drug synthesis
Ethyl 3-oxo-8-azabicyclo[3.2.1]octane-8-carboxylate
Pharmaceutical intermediate for tropane derivatives
DMTr-TNA-5MeU amidite
nucleoside phosphoramidite for oligonucleotide synthesis
Tert-butyl 3-(aminomethyl)azetidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
2-(2-Ethoxyphenoxy)ethyl Bromide
pharmaceutical intermediate for reboxetine
(2S)-2-amino-2-(4-hydroxyphenyl)acetic acid
LJCWONGJFPCTTL-ZETCQYMHSA-N
C1=CC(=CC=C1[C@@H](C(=O)O)N)O