L-Leucine-5,5,5-d3 is a deuterated amino acid used as a research reagent. It is a labeled form of L-leucine where three hydrogen atoms at the 5-position are replaced with deuterium, enabling tracing in metabolic studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 87828-86-2
Piperidine-4-sulfonic acid amide
research compound
1-cyclopropyl-4-isothiocyanatonaphthalene
research compound
Methyl 2-((5-amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazol-3-yl)thio)acetate
Research compound
Fmoc-Tyr(tBu)-Ser(Psi(Me,Me)pro)-OH
Research reagent for peptide synthesis
L-LEUCINE-D7
isotopically labeled amino acid
Deuterated L-leucine
deuterated compound for research
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
deuterated research compound
D-LEUCINE
metabolite research compound
(2S)-2-amino-5,5,5-trideuterio-4-methylpentanoic acid
ROHFNLRQFUQHCH-LONBSJBQSA-N
[2H]C([2H])([2H])C(C)C[C@@H](C(=O)O)N