Leucine-d10 is a deuterated compound used primarily as a research reagent. Its structure features ten deuterium atoms replacing hydrogen, making it valuable for tracing and analytical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 29909-01-1
2,5-Difluorobenzoic acid
research compound
3-(Tris(hydroxymethyl)methylamino)-1-propanesulfonic acid
Biological buffer
Isopropyl bromoacetate
research reagent
4-Aminophenylsulphur pentafluoride
Research chemical for synthesis
D-LEUCINE
metabolite research compound
DL-Leucine
Pharmaceutical intermediate for peptide synthesis
Lösin
nutritional supplement and flavoring agent
L-Leucine-5,5,5-d3
Deuterated amino acid research reagent
2-amino-2,3,3,4,5,5,5-heptadeuterio-4-(trideuteriomethyl)pentanoic acid
ROHFNLRQFUQHCH-SHJFKSRGSA-N
[2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])(C(=O)O)N