2,4,6-Trichlorobenzeneboronic acid is a boronic acid compound containing three chlorine substituents on an aromatic ring. It is primarily used as a research reagent in organic synthesis, particularly in cross-coupling reactions and the preparation of other boron-containing molecules.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 73852-18-3
2,6-Diisopropylphenylboronic acid
boronic acid research compound
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
2-pyrrolidinylphosphonic acid
research compound
2',3',5'-Tri-O-acetyladenosine
Nucleoside research intermediate
(1S)-1-(4-Chlorophenyl)propan-1-ol
research compound for chiral synthesis
4-(Dimethylamino)phenyldiphenylphosphine
Phosphine ligand for cross-coupling reactions
(2,4,6-trichlorophenyl)boronic acid
JWWBOINZBOIAHR-UHFFFAOYSA-N
B(C1=C(C=C(C=C1Cl)Cl)Cl)(O)O
—