2',3',5'-Tri-O-acetyladenosine is a peracetylated derivative of adenosine used as an intermediate in nucleoside research. Its structure features a protected ribose moiety with acetyl groups at the 2', 3', and 5' positions, making it a valuable building block for oligonucleotide synthesis and modification studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 7387-57-7
(1S)-1-(4-Chlorophenyl)propan-1-ol
research compound for chiral synthesis
4-(Dimethylamino)phenyldiphenylphosphine
Phosphine ligand for cross-coupling reactions
2-methylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
research compound
N-(2-amino-2-methylpropyl)-2-methylpyrazolo[1,5-a]pyrimidine-6-carboxamide
research compound
2,3,5-Tri-O-acetyl alpha-adenosine
Pharmaceutical intermediate for adenosine derivatives
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(6-aminopurin-9-yl)oxolan-2-yl]methyl acetate
GCVZNVTXNUTBFB-XNIJJKJLSA-N
CC(=O)OC[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)OC(=O)C)OC(=O)C