2,6-Diisopropylphenylboronic acid is a boronic acid compound used primarily in research. It features a diisopropyl-substituted aromatic ring and a boronic acid functional group, with properties including two hydrogen bond donors and a molecular weight of approximately 206 g/mol.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 363166-79-4
2-boronothiophene-3-carboxylic Acid
boronic acid research compound
2,4,6-Trichlorobenzeneboronic acid
boronic acid research compound
(6-isopropyldibenzo[b,d]furan-4-yl)boronic acid
boronic acid research compound
3,3-difluoropiperidine
research compound
2-Fluoronicotinamide
research compound
1-(Diphenylmethyl)azetidine-3-carboxylic acid
Research compound
Triethylcholine hydroxide
structure-directing agent for synthesis
[2,6-di(propan-2-yl)phenyl]boronic acid
UPXGMXMTUMCLGD-UHFFFAOYSA-N
B(C1=C(C=CC=C1C(C)C)C(C)C)(O)O
—