2,6-Dichlorophenylacetic acid is a chlorinated aromatic carboxylic acid used as a research reagent in organic synthesis. Its structure features a dichlorophenyl ring attached to an acetic acid moiety, contributing to its utility as a building block for further chemical transformations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6575-24-2
2-Fluoro-3-(trifluoromethyl)pyridine
research compound
5-Bromo-4-chloro-3-indolyl phosphate p-toluidine salt
Biochemical staining reagent
2,6-Dichlorobenzenesulfonyl chloride
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
2-(2,6-dichlorophenyl)acetic acid
SFAILOOQFZNOAU-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)CC(=O)O)Cl