4-(Trifluoromethoxy)benzyl Chloride is a chemical compound that serves as a research reagent. It is characterized by the presence of a chloromethyl group and a trifluoromethoxy substituent on an aromatic ring, making it useful in laboratory-scale synthesis and exploratory chemistry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 65796-00-1
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
4-Amino-6-hydroxy-2-mercaptopyrimidine monohydrate
research compound
1-(chloromethyl)-4-(trifluoromethoxy)benzene
LBMKFQMJURUPKC-UHFFFAOYSA-N
C1=CC(=CC=C1CCl)OC(F)(F)F
—