2,6-Dichlorobenzenesulfonyl chloride is a chemical compound used primarily as a reagent in organic synthesis. It features an aromatic ring substituted with chlorine atoms and a sulfonyl chloride group, contributing to its reactivity in laboratory settings.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 6579-54-0
1-ethynyl-4-(trifluoromethyl)benzene
chemical reagent for organic synthesis
(2,6-dimethoxypyridin-3-yl)boronic Acid
chemical reagent for organic synthesis
3-Fluoropyridine
chemical reagent for organic synthesis
4-(Trifluoromethoxy)benzyl Chloride
research compound
4-Nitrophenyl trifluoroacetate
Research reagent for peptide synthesis
Glycyl-L-tyrosine
dipeptide research compound
3,4-Difluorophenylacetic acid
research compound
2,6-dichlorobenzenesulfonyl chloride
WGGKQIKICKLWGN-UHFFFAOYSA-N
C1=CC(=C(C(=C1)Cl)S(=O)(=O)Cl)Cl
—