4-Nitrobenzamide is a chemical compound featuring a benzene ring substituted with a nitro group and a carboxamide group. It is primarily used as a pharmaceutical intermediate in the synthesis of other compounds, including gastroprokinetic agents of the benzamide class.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 619-80-7
4-DIMETHYLAMINOBENZOIC ACID
Sunscreen ester intermediate
4-Nitrobenzoik asit
Intermediate for pharmaceuticals and dyes
3-Chlorobenzyl chloride
synthetic intermediate for pharmaceuticals
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
pharmaceutical intermediate
4-nitrobenzamide
ZESWUEBPRPGMTP-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)N)[N+](=O)[O-]