This compound is a protected beta-amino acid derivative used as a pharmaceutical intermediate. It features a stereochemically defined structure with hydroxyl and carboxybenzyl (Cbz) protecting groups, making it valuable for peptide synthesis and medicinal chemistry research.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 62023-58-9
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
(2S,3S)-3-amino-2-hydroxy-4-phenylbutanoic acid
Pharmaceutical intermediate for impurity studies
Benzenebutanoic acid, beta-amino-alpha-hydroxy-, (R*,S*)-
Impurity reference standard
(2S,3R)-3-((tert-Butoxycarbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
Boc-protected amino acid intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
3-BENZYLOXYCARBONYLAMINO-2-HYDROXY-4-PHENYL-BUTYRIC ACID
research compound for impurity studies
(2S,3R)-3-(((Benzyloxy)carbonyl)amino)-2-hydroxy-4-phenylbutanoic acid
research compound
Carbobenzoxyphenylalanine
protected amino acid for peptide synthesis
(2R,3R)-2-hydroxy-4-phenyl-3-(phenylmethoxycarbonylamino)butanoic acid
JXJYTERRLRAUSF-HZPDHXFCSA-N
C1=CC=C(C=C1)C[C@H]([C@H](C(=O)O)O)NC(=O)OCC2=CC=CC=C2