4-Nitrobenzoik asit
4-Nitrobenzoic acid is a pale yellow organic solid used as an intermediate in the production of pharmaceuticals and dyes. It serves as a precursor to 4-nitrobenzoyl chloride, which is further utilized in the synthesis of compounds such as the anesthetic procaine and folic acid.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 62-23-7
4-CHLOROBENZOTRICHLORIDE
Intermediate for pharmaceuticals and dyes
3-Chlorobenzyl chloride
synthetic intermediate for pharmaceuticals
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
pharmaceutical intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
4-Nitrobenzoic Acid-d4
isotope labeled research compound
4-nitrobenzoic acid
OTLNPYWUJOZPPA-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]