1,2,4-Trimethylbenzene-d12 is a stable isotope labeled research compound where all twelve hydrogen atoms are replaced with deuterium. It is primarily used as a labeled analog in analytical chemistry and metabolic studies to trace the behavior of the parent compound.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 350818-61-0
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
2,3-Dimethylpyridine-d9
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
4-Aminobenzoic Acid-d4
labeled reference standard
2,6-DIMETHYLNAPHTHALENE-D12
deuterated research reference standard
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene
GWHJZXXIDMPWGX-ZPMNDIOMSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]