1,2,4-Trimethylbenzene-d12 is a stable isotope labeled research compound where all twelve hydrogen atoms are replaced with deuterium. It is primarily used as a labeled analog in analytical chemistry and metabolic studies to trace the behavior of the parent compound.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
1,2,4-TRIMETHYLBENZENE-D12 satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
2,3-Dimethylpyridine-d9
Deuterated research compound
(Rac)-Cotinine-d4
isotopically labeled analytical reference standard
4-Aminobenzoic Acid-d4
labeled reference standard
2,6-DIMETHYLNAPHTHALENE-D12
deuterated research reference standard
1,2,4-trideuterio-3,5,6-tris(trideuteriomethyl)benzene
GWHJZXXIDMPWGX-ZPMNDIOMSA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])C([2H])([2H])[2H])C([2H])([2H])[2H])[2H]
1,2,4-TRIMETHYLBENZENE-D12 satın almak mı istiyorsunuz?
Ücretsiz bir satın alma talebi yayınlayın — hesap gerekmez. Talebiniz bu ürünün tedarikçilerine ulaşır, yanıtlar doğrudan e-postanıza gelir.