2,6-Dimethylnaphthalene-d12 is a deuterated research reference standard, where all hydrogen atoms in the molecule are replaced with deuterium. It is primarily used in analytical chemistry as an internal standard or tracer for mass spectrometry and nuclear magnetic resonance spectroscopy.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 350820-12-1
2-Methylnaphthalene-d10
deuterated research standard
Bromo(2H5)benzene
deuterated research reference standard
4-chlorophenol-d4
deuterated research reference standard
Melatonin D4
deuterated research reference standard
(+/-)-Mandelic-2,3,4,5,6-d5 Acid
deuterated research reference standard
Kynurenic Acid-d5
deuterated research compound
1-Bromo-4-nitrobenzene-d4
deuterated research reagent
5-Acetyl-1,3-phenylene diacetate
research compound
1,2,4,5,6,8-hexadeuterio-3,7-bis(trideuteriomethyl)naphthalene
YGYNBBAUIYTWBF-CLWNCLMISA-N
[2H]C1=C(C(=C(C2=C1C(=C(C(=C2[2H])[2H])C([2H])([2H])[2H])[2H])[2H])C([2H])([2H])[2H])[2H]