This compound is a carbon-13 labeled version of 4,6-dichloro-1,3-dinitrobenzene, used as a stable isotope labeled research compound. It is primarily employed in analytical and environmental studies where isotopic tracking is required.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 335081-12-4
1,2,4-TRIMETHYLBENZENE-D12
stable isotope labeled research compound
(2R,3R,5R)-5-(6-Aminopurin-9-yl)-2-(hydroxymethyl)(2,3,4,5-13C4)oxolan-3-ol;hydrate
stable isotope labeled research compound
L-Tyrosine D4
stable isotope labeled research compound
4-CHOLESTEN-3-ONE-4-13C
stable isotope labeled research compound
(3-Chloroprop-1-yn-1-yl)benzene
research compound
Methyl (methylsulfinyl)methyl sulfide
research compound
6-BROMO-DL-TRYPTOPHAN
research compound
Heptafluorobutyric anhydride
derivatising reagent for gas chromatography
1,5-dichloro-2,4-dinitro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene
ZPXDNSYFDIHPOJ-IDEBNGHGSA-N
[13CH]1=[13C]([13C](=[13CH][13C](=[13C]1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-]
—