8-Bromoadenosine is a brominated derivative of adenosine, commonly used as a research reagent. Its structure features a bromine atom at the 8-position of the purine ring, contributing to its utility in biochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2946-39-6
8-Aminoadenosine
adenosine analogue research compound
Gallic acid-d2
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
(2R,3R,4S,5R)-2-(6-amino-8-bromopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
VJUPMOPLUQHMLE-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)Br)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N