8-Aminoadenosine is a purine nucleoside analog featuring an amino group substitution at the 8-position of the adenine base. It is primarily used as a research reagent for studying adenosine receptor interactions and nucleotide metabolism.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 3868-33-5
8-Bromoadenosine
research compound
4-Fluoroindole
organic synthesis building block
7-fluoro-1H-indole
Reagent for chemical synthesis
Lithium Tri-sec-butylborohydride
Mild reducing agent in organic synthesis
4-methoxybenzylmagnesium chloride
Grignard reagent for organic synthesis
(2R,3R,4S,5R)-2-(6,8-diaminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol
DVGWFQILDUEEGX-UUOKFMHZSA-N
C1=NC(=C2C(=N1)N(C(=N2)N)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O)N