Gallic acid-d2 is a deuterium-labeled reference standard of gallic acid, specifically the This compound isotopologue. It is primarily used as an internal standard or tracer in analytical chemistry and research applications requiring quantification or tracking of gallic acid.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 294660-92-7
3-Hydroxyacetaminophen-d3
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
2-bromo-5-phenylthiophene
research compound
1,4,8,11-Tetraazacyclotetradecane
crown amine for metal coordination
Gallic acid
antioxidant, tanning agent, dyeing intermediate
2,6-dideuterio-3,4,5-trihydroxybenzoic acid
LNTHITQWFMADLM-QDNHWIQGSA-N
[2H]C1=C(C(=C(C(=C1O)O)O)[2H])C(=O)O