7-Nitroindazole is a small-molecule compound that selectively inhibits neuronal nitric oxide synthase, an enzyme involved in the production of nitric oxide and cellular signaling. It is primarily used as a research reagent in neurochemical studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 2942-42-9
8-Bromoadenosine
research compound
Gallic acid-d2
Deuterium-labeled reference standard
(2R)-2-(methylamino)propanoic acid
research compound
2-(2-methylprop-2-enoylamino)propanoic acid
Research reagent for organic synthesis
7-nitro-1H-indazole
PQCAUHUKTBHUSA-UHFFFAOYSA-N
C1=CC2=C(C(=C1)[N+](=O)[O-])NN=C2