This compound is a protected amino acid intermediate, specifically the dicyclohexylamine salt of Boc-Ser(tBu)-OH. It is primarily used in laboratory and manufacturing settings for peptide synthesis, where the tert-butyl and Boc groups provide temporary protection for the serine side chain and amino group, respectively.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 18942-50-2
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
pharmaceutical intermediate
(2S)-5-(tert-butoxy)-2-{[(tert-butoxy)carbonyl]amino}-5-oxopentanoic acid
protected amino acid intermediate
N-Carbobenzoxy-L-glutamine
protected amino acid intermediate
N-[(Phenylmethoxy)carbonyl]-L-isoleucine
protected amino acid intermediate
H-His(Trt)-OH
protected amino acid intermediate
Sodium chlorodifluoroacetate
Pharmaceutical intermediate for synthesis
(S)-2-Methyl-1-(6-nitropyridin-3-yl)piperazine
pharmaceutical intermediate
N-cyclohexylcyclohexanamine;(2S)-3-[(2-methylpropan-2-yl)oxy]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
AIEUUHIXSUNTGV-QRPNPIFTSA-N
CC(C)(C)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C.C1CCC(CC1)NC2CCCCC2