H-His(Trt)-OH, or N-trityl-L-histidine, is a protected amino acid derivative commonly used as a pharmaceutical intermediate. Its structure incorporates a trityl (triphenylmethyl) protecting group on the imidazole nitrogen of histidine, making it a versatile building block in peptide synthesis and pharmaceutical manufacturing.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 35146-32-8
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
3-Amino-N-((phenylmethoxy)carbonyl)-D-alanine
protected amino acid intermediate
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
N-Carbobenzoxy-L-glutamine
protected amino acid intermediate
Tert-Butyl (S)-2-carbamoylpyrrolidine-1-carboxylate
protected proline amide intermediate
2'-Hydroxy-3-phenylpropiophenone
Lisdexamfetamine intermediate
N-Ethyl-4-hydroxypiperidine
pharmaceutical intermediate
1,1'-Binaphthyl-2,2'-diyl hydrogen phosphate
chiral reagent for resolution
(2S)-2-amino-3-(1-tritylimidazol-4-yl)propanoic acid
BSZQZNOAYQCQFZ-QHCPKHFHSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)N4C=C(N=C4)C[C@@H](C(=O)O)N