This compound is a protected amino acid derivative featuring a tert-butoxycarbonyl (Boc) protecting group and a methoxy side chain. It is primarily used as an intermediate in the synthesis of peptides and other pharmaceutical compounds.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 86123-95-7
Boc-ser(tbu)-oh dcha
protected amino acid intermediate
(S)-2-Hydroxyethyl 2-amino-3-methylbutanoate 4-methylbenzenesulfonate
pharmaceutical intermediate for acyclovir impurities
Dienogest Impurity G
Pharmaceutical intermediate for dienogest
3-Fluoro-5-iodo-4-methylbenzoic acid
Pharmaceutical intermediate
1-(2,2-DIFLUOROBENZO[D][1,3]DIOXOL-5-YL)CYCLOPROPANECARBONITRILE
pharmaceutical intermediate
2-{[(tert-butoxy)carbonyl]amino}-3-methoxypropanoic acid
Building block for peptide synthesis
(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
RFGMSGRWQUMJIR-ZCFIWIBFSA-N
CC(C)(C)OC(=O)N[C@H](COC)C(=O)O