This compound is a protected amino acid derivative used as a research reagent in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino function and an aminomethyl substituent on the aromatic ring, making it suitable for building modified peptide chains.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 137452-49-4
L-Tyrosine, N-[(1,1-dimethylethoxy)carbonyl]-
Protected amino acid for peptide synthesis
(2S)-2-{[(Tert-Butoxy)Carbonyl]Amino}-3-(4-Iodophenyl)Propanoic Acid
Protected amino acid for peptide synthesis
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-amino-3-(tert-butoxy)propanoic acid
Research compound for peptide synthesis
O-Benzyl-D-serine
Research compound for peptide synthesis
(S)-2-(2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(1-trityl-1H-imidazol-4-yl)propanamido)-2-methylpropanoic acid
Research compound for peptide synthesis
Fmoc-N-methyl-L-alloisoleucine
Research compound for peptide synthesis
(2S)-3-[4-(aminomethyl)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
SRHQPVLBHXDZGC-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)CN)C(=O)O