Boc-O-methyl-L-tyrosine is a protected amino acid intermediate commonly used in peptide synthesis. The compound features a tert-butoxycarbonyl (Boc) protecting group on the amine and a methyl ether on the tyrosine side chain, enabling selective incorporation into peptides.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 53267-93-9
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid
protected amino acid for peptide synthesis
Boc-D-Tyr(Et)-OH
protected amino acid building block
(2S)-2-{[(Tert-Butoxy)Carbonyl]Amino}-3-(4-Iodophenyl)Propanoic Acid
Protected amino acid for peptide synthesis
(2S)-3-[4-(AMINOMETHYL)PHENYL]-2-[(TERT-BUTOXY)CARBONYLAMINO]PROPANOIC ACID
Research compound for peptide synthesis
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
Carbobenzoxyproline
Protected amino acid intermediate
(2S)-3-(4-methoxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid
SLWWWZWJISHVOU-LBPRGKRZSA-N
CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC)C(=O)O