L-Cysteine-d2 is a deuterium-labeled form of the amino acid L-cysteine, specifically deuterated at the beta-carbon. It is primarily used as a research compound for studies involving metabolic tracing and protein labeling.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 130633-02-2
3-Bromo-5-fluorobenzotrifluoride
research reagent
Hexyl (amino(4-aminophenyl)methylene)carbamate hydrochloride
research compound
(3-(Dibenzo[b,d]thiophen-4-yl)phenyl)boronic acid
Boronic acid building block
Bicyclo[2.2.1]hept-5-en-2-ol
chemical intermediate for synthesis
D-Cysteine hydrochloride
research compound
Cystein chloride
dough conditioner and nutritional supplement
L-cysteine
Flavor and nutrition additive
L-Cysteine hydrochloride monohydrate
flavor enhancer and nutritional supplement
(2R)-2-amino-3,3-dideuterio-3-sulfanylpropanoic acid
XUJNEKJLAYXESH-XFJCSJJYSA-N
[2H]C([2H])([C@@H](C(=O)O)N)S