This compound is a ruthenium-based asymmetric hydrogenation catalyst, commonly used in research and development for the synthesis of enantiomerically enriched compounds. It features a chiral diphosphine ligand coordinated to ruthenium, enabling high selectivity in reduction reactions.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 130004-33-0
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
chiral ruthenium catalyst for asymmetric synthesis
[Rh COD (R)-Binap]BF4
homogeneous hydrogenation catalyst
(S)-(-)-binap-chloro-(benzol)ruthenium-chloride
asymmetric catalysis reagent
[(R)-(+)-2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl]palladium(II) chloride
asymmetric catalysis research reagent
2-Chloro-4,6-bis(phenyl-d5)-1,3,5-triazine
Deuterated research standard
(1,10-Phenanthroline)(trifluoromethyl)copper(I)
research reagent for cross-coupling reactions
L-Methionine-d3
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
dichlororuthenium;[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane;1-methyl-4-propan-2-ylbenzene
WNHLGYRPKARUHY-UHFFFAOYSA-L
CC1=CC=C(C=C1)C(C)C.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.Cl[Ru]Cl