l-Methionine-d3 is a deuterated form of the amino acid L-methionine, commonly used as an isotopically labeled research compound. It is primarily applied in analytical and metabolic studies to trace biochemical pathways or quantify methionine-related processes.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 13010-53-2
Dopamine-d4 hydrochloride
isotopically labeled research compound
Rac Ambrisentan-d3 Methyl Ester
isotopically labeled research compound
Butyryl-L-carnitine-d3 (chloride)
isotopically labeled research compound
Carbon-13C monoxide
isotopically labeled research compound
Propan-2-yl-oxocyclobutane carboxylate
research compound
1-Bromohexane-d13
Deuterated research reagent
Methyl 4,4-difluoropiperidine-2-carboxylate
research compound
(-)-tert-Butyl glycidyl ether
research compound
(2S)-2-amino-4-(trideuteriomethylsulfanyl)butanoic acid
FFEARJCKVFRZRR-OSIBIXDNSA-N
[2H]C([2H])([2H])SCC[C@@H](C(=O)O)N