Dopamine-d4 hydrochloride is an isotopically labeled form of dopamine, where four hydrogen atoms are replaced with deuterium. It is primarily used as a research compound for analytical and tracer studies.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 203633-19-6
L-Methionine-d3
isotopically labeled research compound
Mesityl-d10 oxide
isotopically labeled research compound
1,2-bis(trideuteriomethyl)benzene
isotopically labeled research compound
Propane-1,1-d2, 1-iodo-
isotopically labeled research compound
Benzene-d5, methyl-d3-
NMR solvent
Transportan (trifluoroacetate salt)
cell-penetrating peptide research tool
2-Aminopyridine-d6 naphthol
deuterated research compound
DL-Valine-2,3,4,4,4,5,5,5-d8
Deuterium-labeled amino acid standard
4-(2-amino-1,1,2,2-tetradeuterioethyl)benzene-1,2-diol;hydrochloride
CTENFNNZBMHDDG-URZLSVTISA-N
[2H]C([2H])(C1=CC(=C(C=C1)O)O)C([2H])([2H])N.Cl