This compound is a palladium complex coordinated with a chiral diphosphine ligand, commonly known as a dichloropalladium(II) complex of 2,2'-bis(diphenylphosphino)-1,1'-binaphthalene. It is primarily utilized as a catalyst in asymmetric synthesis research due to its ability to induce enantioselectivity in various organic transformations.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 127593-28-6
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
(R)-[2,2'-Bis(diphenylphosphino)-1,1'-binaphthyl dichlororuthenium
chiral ruthenium catalyst for asymmetric synthesis
(S)-RuCl[(p-cymene(BINAP)Cl
asymmetric hydrogenation catalyst
CIS-((S)-BINAP)NI(O-TOLYL)CL
asymmetric catalysis research reagent
4-NITROTOLUENE-2,3,5,6-D4
deuterated research reagent
Ractopamine-d6 Hydrochloride
deuterated internal standard for analysis
3,4-Dichlorobiphenyl-2',3',4',5',6'-d5
Deuterated analytical reference standard
Hydroxy Atrazine-d5
deuterated analytical reference standard
dichloropalladium;[1-(2-diphenylphosphanylnaphthalen-1-yl)naphthalen-2-yl]-diphenylphosphane
VDHAUMFISVWIRX-UHFFFAOYSA-L
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C(C4=CC=CC=C4C=C3)C5=C(C=CC6=CC=CC=C65)P(C7=CC=CC=C7)C8=CC=CC=C8.Cl[Pd]Cl