Menaquinone 7-d7 is a stable isotope labeled research compound used primarily for analytical and investigative purposes. It is a deuterated form of menaquinone-7 that is used as an internal standard in mass spectrometry.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1233937-31-9
1,14-TETRADECANEDIOIC-D24 ACID
stable isotope labeled research compound
Myristoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
Palmitoyl-L-carnitine-d3 Hydrochloride
stable isotope labeled research compound
4,6-Dichloro-1,3-dinitrobenzene-13C6
stable isotope labeled research compound
1-(5-Bromo-4-chlorothiophen-2-yl)ethan-1-one
research compound
XMD 8-92
protein kinase inhibitor research tool
2-Chloroethyl trityl ether
research compound
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
5,6,7,8-tetradeuterio-2-[(2E,6E,10E,14E,18E,22E)-3,7,11,15,19,23,27-heptamethyloctacosa-2,6,10,14,18,22,26-heptaenyl]-3-(trideuteriomethyl)naphthalene-1,4-dione
RAKQPZMEYJZGPI-HRQALKRPSA-N
[2H]C1=C(C(=C2C(=C1[2H])C(=O)C(=C(C2=O)C([2H])([2H])[2H])C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)[2H])[2H]