2-Chloroethyl trityl ether is a research compound featuring a trityl group linked to a 2-chloroethyl ether moiety. It contains three aromatic rings, an ether linkage, and a chlorine atom, and is typically supplied as a laboratory reagent for synthetic chemistry applications.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1235-23-0
Pentamethylcyclopentadienyliridium dichloride
organometallic synthesis reagent
P7C3-A20
research compound
(4-(1-(2-cyano-1-cyclopentylethyl)-1h-pyrazol-4-yl)-7h-pyrrolo[2,3-d]pyrimidin-7-yl)methyl pivalate
research compound
N-(5-Methoxy-2-Phenoxyphenyl)methanesulfonamide
Research compound
[2-chloroethoxy(diphenyl)methyl]benzene
SYWFBBWOXLVTAN-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCCCl