Illudin S is a naturally occurring sesquiterpene compound found in certain poisonous mushrooms. It is primarily used as a research compound due to its unique molecular structure and biological activity.
İçerik kapsamı: Bu sayfadaki bilgiler kimyasal tanımlama ile endüstriyel tedarik, araştırma ve üretim bağlamlarına ilişkindir. Tedavi iddiası, tıbbi tavsiye veya ilaç kullanım talimatı niteliği taşımaz.
Bu bileşiği tedarik ediyor veya sağlıyor musunuz?
Envanterinizi listeleyin veya satın alma talebi gönderin
CAS 1149-99-1
1-Succinimidyl-3'-pyrenebutyrate
Fluorescent labeling reagent
Benzyltrimethylammonium dichloroiodate
Phase transfer catalyst
2-Propenoic acid, 2-methyl-, 1-(1-methylethyl)cyclopentyl ester
research compound
Triethyl orthopropionate
Organic synthesis reagent
Illudin M
research compound
(1R,2S,5R)-1,5-dihydroxy-2-(hydroxymethyl)-2,5,7-trimethylspiro[1H-indene-6,1'-cyclopropane]-4-one
DDLLIYKVDWPHJI-RDBSUJKOSA-N
CC1=C2[C@H]([C@](C=C2C(=O)[C@](C13CC3)(C)O)(C)CO)O